CAS 43045-08-5 is the registry number for 4-(2-Chlorophenyl)-2,3-dihydro-1,3-thiazol-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(2-chlorophenyl)-3H-1,3-thiazol-2-one (CAS 43045-08-5) is a chemical compound with the molecular formula C9H6ClNOS and a molecular weight of 211.67 g/mol. IUPAC name: 4-(2-chlorophenyl)-3H-1,3-thiazol-2-one. InChIKey: VFKMIMZLKKBRND-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNOS |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 4-(2-chlorophenyl)-3H-1,3-thiazol-2-one |
| InChIKey | VFKMIMZLKKBRND-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC(=O)N2)Cl |
Computed by PubChem (NCBI)