CAS 49656-34-0 is the registry number for 5-(4-Chlorophenyl)oxazole-2-thiol, 97%. Offered by: AmBeed. Available pack sizes: 5g.
5-(4-chlorophenyl)-3H-1,3-oxazole-2-thione (CAS 49656-34-0) is a chemical compound with the molecular formula C9H6ClNOS and a molecular weight of 211.67 g/mol. IUPAC name: 5-(4-chlorophenyl)-3H-1,3-oxazole-2-thione. InChIKey: WRHYNFLKUOROFK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNOS |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-3H-1,3-oxazole-2-thione |
| InChIKey | WRHYNFLKUOROFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CNC(=S)O2)Cl |
Computed by PubChem (NCBI)