CAS 1706527-37-8 is the registry number for 2-(4-Chlorophenyl)thiazol-4(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-chlorophenyl)-1,3-thiazol-4-one (CAS 1706527-37-8) is a chemical compound with the molecular formula C9H6ClNOS and a molecular weight of 211.67 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-thiazol-4-one. InChIKey: GJLOUADPVKVGII-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNOS |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-thiazol-4-one |
| InChIKey | GJLOUADPVKVGII-UHFFFAOYSA-N |
| SMILES | C1C(=O)N=C(S1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)