CAS 19339-59-4 is the registry number for 4-Chlorophenacyl thiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[2-(4-chlorophenyl)-2-oxoethyl] thiocyanate (CAS 19339-59-4) is a chemical compound with the molecular formula C9H6ClNOS and a molecular weight of 211.67 g/mol. IUPAC name: [2-(4-chlorophenyl)-2-oxoethyl] thiocyanate. InChIKey: JSIQRJQKMVTGJN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNOS |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | [2-(4-chlorophenyl)-2-oxoethyl] thiocyanate |
| InChIKey | JSIQRJQKMVTGJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CSC#N)Cl |
Computed by PubChem (NCBI)