CAS 33319-85-6 appears in our catalog under these names: 2-(3-Chlorophenyl)-2,3-dihydro-1,2-thiazol-3-one, 95%, 2-(3-Chlorophenyl)-2,3-dihydro-1,2-thiazol-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(3-chlorophenyl)-1,2-thiazol-3-one (CAS 33319-85-6) is a chemical compound with the molecular formula C9H6ClNOS and a molecular weight of 211.67 g/mol. IUPAC name: 2-(3-chlorophenyl)-1,2-thiazol-3-one. InChIKey: PLGUAGAZYIMLFF-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNOS |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1,2-thiazol-3-one |
| InChIKey | PLGUAGAZYIMLFF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C(=O)C=CS2 |
Computed by PubChem (NCBI)