CAS 2103-98-2 is the registry number for 4-(4-chlorophenyl)-1,3-thiazol-2-ol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 50g, 25g, 1g.
4-(4-chlorophenyl)-3H-1,3-thiazol-2-one (CAS 2103-98-2) is a chemical compound with the molecular formula C9H6ClNOS and a molecular weight of 211.67 g/mol. IUPAC name: 4-(4-chlorophenyl)-3H-1,3-thiazol-2-one. InChIKey: XODFWCAVOQHJFC-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNOS |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-3H-1,3-thiazol-2-one |
| InChIKey | XODFWCAVOQHJFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=O)N2)Cl |
Computed by PubChem (NCBI)