CAS 1095051-83-4 appears in our catalog under these names: 5-Ethyl-4-phenyl-2,3-dihydro-1,3-thiazol-2-one, 95%, 5-Ethyl-4-phenyl-2,3-dihydro-1,3-thiazol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-ethyl-4-phenyl-3H-1,3-thiazol-2-one (CAS 1095051-83-4) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: 5-ethyl-4-phenyl-3H-1,3-thiazol-2-one. InChIKey: CIPBLWZURGPAOC-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 5-ethyl-4-phenyl-3H-1,3-thiazol-2-one |
| InChIKey | CIPBLWZURGPAOC-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC(=O)S1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)