CAS 1096323-75-9 is the registry number for Methyl (4-formyl-2-methoxy-5-nitrophenoxy)acetate, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-(4-formyl-2-methoxy-5-nitrophenoxy)acetate (CAS 1096323-75-9) is a chemical compound with the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. IUPAC name: methyl 2-(4-formyl-2-methoxy-5-nitrophenoxy)acetate. InChIKey: XINSZEQRFPEALJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO7 |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | methyl 2-(4-formyl-2-methoxy-5-nitrophenoxy)acetate |
| InChIKey | XINSZEQRFPEALJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OCC(=O)OC |
Computed by PubChem (NCBI)