Products 1335210-31-5

CAS 1335210-31-5 is the registry number for Dolutegravir Impurity 53. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methoxy-6-methoxycarbonyl-4-oxo-1-(2-oxoethyl)pyridine-3-carboxylic acid (CAS 1335210-31-5) is a chemical compound with the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. IUPAC name: 5-methoxy-6-methoxycarbonyl-4-oxo-1-(2-oxoethyl)pyridine-3-carboxylic acid. InChIKey: YCRKGMQGGNAAEN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO7
Molecular weight269.21 g/mol
IUPAC name5-methoxy-6-methoxycarbonyl-4-oxo-1-(2-oxoethyl)pyridine-3-carboxylic acid
InChIKeyYCRKGMQGGNAAEN-UHFFFAOYSA-N
SMILESCOC1=C(N(C=C(C1=O)C(=O)O)CC=O)C(=O)OC

Computed by PubChem (NCBI)