CAS 1335210-31-5 is the registry number for Dolutegravir Impurity 53. Offered by: Chemat Brand. Available pack sizes: on request.
5-methoxy-6-methoxycarbonyl-4-oxo-1-(2-oxoethyl)pyridine-3-carboxylic acid (CAS 1335210-31-5) is a chemical compound with the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. IUPAC name: 5-methoxy-6-methoxycarbonyl-4-oxo-1-(2-oxoethyl)pyridine-3-carboxylic acid. InChIKey: YCRKGMQGGNAAEN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO7 |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | 5-methoxy-6-methoxycarbonyl-4-oxo-1-(2-oxoethyl)pyridine-3-carboxylic acid |
| InChIKey | YCRKGMQGGNAAEN-UHFFFAOYSA-N |
| SMILES | COC1=C(N(C=C(C1=O)C(=O)O)CC=O)C(=O)OC |
Computed by PubChem (NCBI)