CAS 856806-20-7 is the registry number for Dimethyl 4-methoxy-5-nitrophthalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Dimethyl 4-methoxy-5-nitrobenzene-1,2-dicarboxylate (CAS 856806-20-7) is a chemical compound with the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. IUPAC name: dimethyl 4-methoxy-5-nitrobenzene-1,2-dicarboxylate. InChIKey: ZGASGVVPYSDBEA-UHFFFAOYSA-N.
| Molecular formula | C11H11NO7 |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | dimethyl 4-methoxy-5-nitrobenzene-1,2-dicarboxylate |
| InChIKey | ZGASGVVPYSDBEA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)