Products 138035-71-9

CAS 138035-71-9 is the registry number for 3-Methoxycarbonylmethoxy-4-nitro-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-(2-methoxy-2-oxoethoxy)-4-nitrobenzoate (CAS 138035-71-9) is a chemical compound with the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. IUPAC name: methyl 3-(2-methoxy-2-oxoethoxy)-4-nitrobenzoate. InChIKey: LSAYBLOZWLGJSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO7
Molecular weight269.21 g/mol
IUPAC namemethyl 3-(2-methoxy-2-oxoethoxy)-4-nitrobenzoate
InChIKeyLSAYBLOZWLGJSQ-UHFFFAOYSA-N
SMILESCOC(=O)COC1=C(C=CC(=C1)C(=O)OC)[N+](=O)[O-]

Computed by PubChem (NCBI)