Products 860189-86-2

CAS 860189-86-2 is the registry number for 3-(4,5-Dimethoxy-2-nitrophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4,5-dimethoxy-2-nitrophenyl)-2-oxopropanoic acid (CAS 860189-86-2) is a chemical compound with the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. IUPAC name: 3-(4,5-dimethoxy-2-nitrophenyl)-2-oxopropanoic acid. InChIKey: UGKPBLMZXPCXSN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO7
Molecular weight269.21 g/mol
IUPAC name3-(4,5-dimethoxy-2-nitrophenyl)-2-oxopropanoic acid
InChIKeyUGKPBLMZXPCXSN-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)CC(=O)C(=O)O)[N+](=O)[O-])OC

Computed by PubChem (NCBI)