CAS 236418-39-6 is the registry number for Ethyl 2-((4-nitrophenoxy)carbonyloxy)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 2-(4-nitrophenoxy)carbonyloxyacetate (CAS 236418-39-6) is a chemical compound with the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. IUPAC name: ethyl 2-(4-nitrophenoxy)carbonyloxyacetate. InChIKey: OWMYKBJNYREDMU-UHFFFAOYSA-N.
| Molecular formula | C11H11NO7 |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | ethyl 2-(4-nitrophenoxy)carbonyloxyacetate |
| InChIKey | OWMYKBJNYREDMU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)