Products 662154-26-9

CAS 662154-26-9 is the registry number for 2-(2-Formyl-6-methoxy-4-nitrophenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(2-formyl-6-methoxy-4-nitrophenoxy)propanoic acid (CAS 662154-26-9) is a chemical compound with the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. IUPAC name: 2-(2-formyl-6-methoxy-4-nitrophenoxy)propanoic acid. InChIKey: MIQCEOGOTBKVCB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO7
Molecular weight269.21 g/mol
IUPAC name2-(2-formyl-6-methoxy-4-nitrophenoxy)propanoic acid
InChIKeyMIQCEOGOTBKVCB-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=C(C=C(C=C1OC)[N+](=O)[O-])C=O

Computed by PubChem (NCBI)