Products 897656-36-9
CAS 897656-36-9 appears in our catalog under these names: N-Methoxy-n-methyl-4-(trifluoromethoxy)benzamide, 95%, N-Methoxy-N-methyl-4-(trifluoromethoxy)benzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
N-methoxy-N-methyl-4-(trifluoromethoxy)benzamide (CAS 897656-36-9) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: N-methoxy-N-methyl-4-(trifluoromethoxy)benzamide. InChIKey: VFYQAVXEGGXXQE-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | N-methoxy-N-methyl-4-(trifluoromethoxy)benzamide |
| InChIKey | VFYQAVXEGGXXQE-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC=C(C=C1)OC(F)(F)F)OC |
Computed by PubChem (NCBI)