CAS 1096955-27-9 is the registry number for 2-(2-(1-Benzofuran-2-yl)-1,3-thiazol-4-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[2-(1-benzofuran-2-yl)-1,3-thiazol-4-yl]acetic acid (CAS 1096955-27-9) is a chemical compound with the molecular formula C13H9NO3S and a molecular weight of 259.28 g/mol. IUPAC name: 2-[2-(1-benzofuran-2-yl)-1,3-thiazol-4-yl]acetic acid. InChIKey: WCWZBYXPAOQEBQ-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 2-[2-(1-benzofuran-2-yl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | WCWZBYXPAOQEBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=NC(=CS3)CC(=O)O |
Computed by PubChem (NCBI)