Products 1096955-27-9

CAS 1096955-27-9 is the registry number for 2-(2-(1-Benzofuran-2-yl)-1,3-thiazol-4-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[2-(1-benzofuran-2-yl)-1,3-thiazol-4-yl]acetic acid (CAS 1096955-27-9) is a chemical compound with the molecular formula C13H9NO3S and a molecular weight of 259.28 g/mol. IUPAC name: 2-[2-(1-benzofuran-2-yl)-1,3-thiazol-4-yl]acetic acid. InChIKey: WCWZBYXPAOQEBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9NO3S
Molecular weight259.28 g/mol
IUPAC name2-[2-(1-benzofuran-2-yl)-1,3-thiazol-4-yl]acetic acid
InChIKeyWCWZBYXPAOQEBQ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=C(O2)C3=NC(=CS3)CC(=O)O

Computed by PubChem (NCBI)