CAS 1469294-49-2 appears in our catalog under these names: Methyl 4-oxo-4,5-dihydrothieno(3,2-c)quinoline-2-carboxylate, 98%, Methyl 4-oxo-4H,5H-thieno(3,2-c)quinoline-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylate (CAS 1469294-49-2) is a chemical compound with the molecular formula C13H9NO3S and a molecular weight of 259.28 g/mol. IUPAC name: methyl 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylate. InChIKey: HYCQXNSBAQYRQX-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | methyl 4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylate |
| InChIKey | HYCQXNSBAQYRQX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)