CAS 15449-00-0 is the registry number for 2-Phenylbenzo[d]isothiazol-3(2H)-one 1,1-dioxide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one (CAS 15449-00-0) is a chemical compound with the molecular formula C13H9NO3S and a molecular weight of 259.28 g/mol. IUPAC name: 1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one. InChIKey: BPCIWMIPHVSEJO-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one |
| InChIKey | BPCIWMIPHVSEJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3S2(=O)=O |
Computed by PubChem (NCBI)