CAS 22871-33-6 appears in our catalog under these names: Dibenzo(b,f)(1,4)thiazepin-11(10H)-one 5,5-Dioxide, Quetiapine impurity 16. Offered by: Mikromol, MedChemExpress. Available pack sizes: 25mg, Get quote.
11,11-dioxo-5H-benzo[b][1,4]benzothiazepin-6-one (CAS 22871-33-6) is a chemical compound with the molecular formula C13H9NO3S and a molecular weight of 259.28 g/mol. IUPAC name: 11,11-dioxo-5H-benzo[b][1,4]benzothiazepin-6-one. InChIKey: QQJWUMVPNHSILZ-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 11,11-dioxo-5H-benzo[b][1,4]benzothiazepin-6-one |
| InChIKey | QQJWUMVPNHSILZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=CC=CC=C3S2(=O)=O |
Computed by PubChem (NCBI)