Products 408328-97-2
CAS 408328-97-2 is the registry number for Benzo(H)Quinoline–10–SulfonicAcid. Offered by: GLPBio. Available pack sizes: 200mg.
Benzo[h]quinoline-10-sulfonic acid (CAS 408328-97-2) is a chemical compound with the molecular formula C13H9NO3S and a molecular weight of 259.28 g/mol. IUPAC name: benzo[h]quinoline-10-sulfonic acid. InChIKey: QCMKVOONDDDSIL-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | benzo[h]quinoline-10-sulfonic acid |
| InChIKey | QCMKVOONDDDSIL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)O)C3=C(C=CC=N3)C=C2 |
Computed by PubChem (NCBI)
Synonyms:
benzo[h]quinoline-10-sulfonic acid