CAS 351358-68-4 is the registry number for 7-Methoxy-thieno[2,3-b]quinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
7-methoxythieno[2,3-b]quinoline-2-carboxylic acid (CAS 351358-68-4) is a chemical compound with the molecular formula C13H9NO3S and a molecular weight of 259.28 g/mol. IUPAC name: 7-methoxythieno[2,3-b]quinoline-2-carboxylic acid. InChIKey: FBYCIVDGRKVDGV-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 7-methoxythieno[2,3-b]quinoline-2-carboxylic acid |
| InChIKey | FBYCIVDGRKVDGV-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC3=C(C=C2C=C1)C=C(S3)C(=O)O |
Computed by PubChem (NCBI)