CAS 1897826-70-8 is the registry number for 5–(5–Hydroxybenzo(b)thiophen–2–yl)–1H–pyrrole–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg.
5-(5-hydroxy-1-benzothiophen-2-yl)-1H-pyrrole-2-carboxylic acid (CAS 1897826-70-8) is a chemical compound with the molecular formula C13H9NO3S and a molecular weight of 259.28 g/mol. IUPAC name: 5-(5-hydroxy-1-benzothiophen-2-yl)-1H-pyrrole-2-carboxylic acid. InChIKey: FUOGIAIWMVMESN-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 5-(5-hydroxy-1-benzothiophen-2-yl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | FUOGIAIWMVMESN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C=C(S2)C3=CC=C(N3)C(=O)O |
Computed by PubChem (NCBI)