Products 1097670-98-8

CAS 1097670-98-8 is the registry number for 4-(1H-1,2,3-Triazol-1-yl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(triazol-1-yl)benzenesulfonyl chloride (CAS 1097670-98-8) is a chemical compound with the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. IUPAC name: 4-(triazol-1-yl)benzenesulfonyl chloride. InChIKey: ULILODVETLTVNH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClN3O2S
Molecular weight243.67 g/mol
IUPAC name4-(triazol-1-yl)benzenesulfonyl chloride
InChIKeyULILODVETLTVNH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N2C=CN=N2)S(=O)(=O)Cl

Computed by PubChem (NCBI)