Products 1532190-93-4

CAS 1532190-93-4 appears in our catalog under these names: 3-(1H-1,2,3-Triazol-1-yl)benzene-1-sulfonyl chloride, 95%, 3-(1H-1,2,3-Triazol-1-yl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

3-(triazol-1-yl)benzenesulfonyl chloride (CAS 1532190-93-4) is a chemical compound with the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. IUPAC name: 3-(triazol-1-yl)benzenesulfonyl chloride. InChIKey: IEJFTXPDHBCJNL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClN3O2S
Molecular weight243.67 g/mol
IUPAC name3-(triazol-1-yl)benzenesulfonyl chloride
InChIKeyIEJFTXPDHBCJNL-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(=O)(=O)Cl)N2C=CN=N2

Computed by PubChem (NCBI)