CAS 1532190-93-4 appears in our catalog under these names: 3-(1H-1,2,3-Triazol-1-yl)benzene-1-sulfonyl chloride, 95%, 3-(1H-1,2,3-Triazol-1-yl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(triazol-1-yl)benzenesulfonyl chloride (CAS 1532190-93-4) is a chemical compound with the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. IUPAC name: 3-(triazol-1-yl)benzenesulfonyl chloride. InChIKey: IEJFTXPDHBCJNL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | 3-(triazol-1-yl)benzenesulfonyl chloride |
| InChIKey | IEJFTXPDHBCJNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)N2C=CN=N2 |
Computed by PubChem (NCBI)