CAS 1600335-61-2 is the registry number for 1-Phenyl-1H-1,2,3-triazole-5-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-phenyltriazole-4-sulfonyl chloride (CAS 1600335-61-2) is a chemical compound with the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. IUPAC name: 3-phenyltriazole-4-sulfonyl chloride. InChIKey: XVIFRJNANZCJNU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | 3-phenyltriazole-4-sulfonyl chloride |
| InChIKey | XVIFRJNANZCJNU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CN=N2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)