CAS 1578246-63-5 appears in our catalog under these names: 8-Chloro-2-(methylsulfonyl)pyrido[3,4-d]pyrimidine, 97%, 97%, 8-Chloro-2-(methylsulfonyl)pyrido[3,4-d]pyrimidine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
8-chloro-2-methylsulfonylpyrido[3,4-d]pyrimidine (CAS 1578246-63-5) is a chemical compound with the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. IUPAC name: 8-chloro-2-methylsulfonylpyrido[3,4-d]pyrimidine. InChIKey: SWDQPJHFRZZXDQ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | 8-chloro-2-methylsulfonylpyrido[3,4-d]pyrimidine |
| InChIKey | SWDQPJHFRZZXDQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C2C=CN=C(C2=N1)Cl |
Computed by PubChem (NCBI)