Products 1895195-83-1

CAS 1895195-83-1 appears in our catalog under these names: 1-Phenyl-1H-1,2,3-triazole-4-sulfonyl chloride, 95%, 1-Phenyl-1H-1,2,3-triazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

1-phenyltriazole-4-sulfonyl chloride (CAS 1895195-83-1) is a chemical compound with the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. IUPAC name: 1-phenyltriazole-4-sulfonyl chloride. InChIKey: NGNQIUAQGPWARV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClN3O2S
Molecular weight243.67 g/mol
IUPAC name1-phenyltriazole-4-sulfonyl chloride
InChIKeyNGNQIUAQGPWARV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C=C(N=N2)S(=O)(=O)Cl

Computed by PubChem (NCBI)