CAS 871231-32-2 is the registry number for Methyl 2-amino-4-chlorothieno[2,3-d]pyrimidine-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-amino-4-chlorothieno[2,3-d]pyrimidine-6-carboxylate (CAS 871231-32-2) is a chemical compound with the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. IUPAC name: methyl 2-amino-4-chlorothieno[2,3-d]pyrimidine-6-carboxylate. InChIKey: ZGZWSNOLWQLXDZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | methyl 2-amino-4-chlorothieno[2,3-d]pyrimidine-6-carboxylate |
| InChIKey | ZGZWSNOLWQLXDZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)N=C(N=C2Cl)N |
Computed by PubChem (NCBI)