CAS 517919-17-4 is the registry number for 4-(2H-1,2,3-Triazol-2-yl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(triazol-2-yl)benzenesulfonyl chloride (CAS 517919-17-4) is a chemical compound with the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. IUPAC name: 4-(triazol-2-yl)benzenesulfonyl chloride. InChIKey: NJJPEXICSUBIBZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | 4-(triazol-2-yl)benzenesulfonyl chloride |
| InChIKey | NJJPEXICSUBIBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2N=CC=N2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)