Products 1097731-30-0

CAS 1097731-30-0 appears in our catalog under these names: 2-Methyl-2h-indazole-5-sulfonyl chloride, 95%, 2-Methyl-2H-indazole-5-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g.

Structural formula: {0} (CAS {1})

2-methylindazole-5-sulfonyl chloride (CAS 1097731-30-0) is a chemical compound with the molecular formula C8H7ClN2O2S and a molecular weight of 230.67 g/mol. IUPAC name: 2-methylindazole-5-sulfonyl chloride. InChIKey: AQKYXMWGYKMGPB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClN2O2S
Molecular weight230.67 g/mol
IUPAC name2-methylindazole-5-sulfonyl chloride
InChIKeyAQKYXMWGYKMGPB-UHFFFAOYSA-N
SMILESCN1C=C2C=C(C=CC2=N1)S(=O)(=O)Cl

Computed by PubChem (NCBI)