Products 218920-93-5
CAS 218920-93-5 is the registry number for 4-Chloro-N-(cyanomethyl)benzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-(cyanomethyl)benzenesulfonamide (CAS 218920-93-5) is a chemical compound with the molecular formula C8H7ClN2O2S and a molecular weight of 230.67 g/mol. IUPAC name: 4-chloro-N-(cyanomethyl)benzenesulfonamide. InChIKey: IBWFPJGDOBWFRS-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2S |
|---|---|
| Molecular weight | 230.67 g/mol |
| IUPAC name | 4-chloro-N-(cyanomethyl)benzenesulfonamide |
| InChIKey | IBWFPJGDOBWFRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)NCC#N)Cl |
Computed by PubChem (NCBI)