CAS 1209007-31-7 is the registry number for 2-Aminothieno(2,3-c)pyridine-3-carboxylic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-aminothieno[2,3-c]pyridine-3-carboxylic acid;hydrochloride (CAS 1209007-31-7) is a chemical compound with the molecular formula C8H7ClN2O2S and a molecular weight of 230.67 g/mol. IUPAC name: 2-aminothieno[2,3-c]pyridine-3-carboxylic acid;hydrochloride. InChIKey: FVUXMOQGFFTLSQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2S |
|---|---|
| Molecular weight | 230.67 g/mol |
| IUPAC name | 2-aminothieno[2,3-c]pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | FVUXMOQGFFTLSQ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=C(S2)N)C(=O)O.Cl |
Computed by PubChem (NCBI)