Products 1447647-93-9
CAS 1447647-93-9 is the registry number for 1-Methyl-1H-pyrrolo[3,2-b]pyridine-3-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methylpyrrolo[3,2-b]pyridine-3-sulfonyl chloride (CAS 1447647-93-9) is a chemical compound with the molecular formula C8H7ClN2O2S and a molecular weight of 230.67 g/mol. IUPAC name: 1-methylpyrrolo[3,2-b]pyridine-3-sulfonyl chloride. InChIKey: GQRDLLWNWVTECP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2S |
|---|---|
| Molecular weight | 230.67 g/mol |
| IUPAC name | 1-methylpyrrolo[3,2-b]pyridine-3-sulfonyl chloride |
| InChIKey | GQRDLLWNWVTECP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=CC=N2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)