CAS 1363381-73-0 appears in our catalog under these names: 2-Methyl-2h-indazole-4-sulfonyl chloride, 95%, 2-Methyl-2H-indazole-4-sulfonyl chloride, 97%, 2–Methyl–2H–indazole–4–sulfonyl chloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
2-methylindazole-4-sulfonyl chloride (CAS 1363381-73-0) is a chemical compound with the molecular formula C8H7ClN2O2S and a molecular weight of 230.67 g/mol. IUPAC name: 2-methylindazole-4-sulfonyl chloride. InChIKey: BMJXULOIFQMBII-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2S |
|---|---|
| Molecular weight | 230.67 g/mol |
| IUPAC name | 2-methylindazole-4-sulfonyl chloride |
| InChIKey | BMJXULOIFQMBII-UHFFFAOYSA-N |
| SMILES | CN1C=C2C(=N1)C=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)