CAS 1432063-51-8 appears in our catalog under these names: Diazoxide-d3, Diazoxide-d3, >95% (HPLC), Diazoxide–d3. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 1 mg.
7-chloro-3-(trideuteriomethyl)-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CAS 1432063-51-8) is a chemical compound with the molecular formula C8H7ClN2O2S and a molecular weight of 233.69 g/mol. IUPAC name: 7-chloro-3-(trideuteriomethyl)-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide. InChIKey: GDLBFKVLRPITMI-FIBGUPNXSA-N.
| Molecular formula | C8H7ClN2O2S |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 7-chloro-3-(trideuteriomethyl)-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| InChIKey | GDLBFKVLRPITMI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NS(=O)(=O)C2=C(N1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)