Products 109791-19-7

CAS 109791-19-7 is the registry number for Bisoprolol Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methoxy]acetic acid (CAS 109791-19-7) is a chemical compound with the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. IUPAC name: 2-[[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methoxy]acetic acid. InChIKey: ZEAYEMJBEYLWSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23NO5
Molecular weight297.35 g/mol
IUPAC name2-[[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]methoxy]acetic acid
InChIKeyZEAYEMJBEYLWSQ-UHFFFAOYSA-N
SMILESCC(C)NCC(COC1=CC=C(C=C1)COCC(=O)O)O

Computed by PubChem (NCBI)