CAS 35385-10-5 is the registry number for Glyco-amphetamine. Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1-phenylpropan-2-ylamino)oxane-3,4,5-triol (CAS 35385-10-5) is a chemical compound with the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1-phenylpropan-2-ylamino)oxane-3,4,5-triol. InChIKey: SGWHGUIQACNBIX-XPMBSJARSA-N.
| Molecular formula | C15H23NO5 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1-phenylpropan-2-ylamino)oxane-3,4,5-triol |
| InChIKey | SGWHGUIQACNBIX-XPMBSJARSA-N |
| SMILES | CC(CC1=CC=CC=C1)NC2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)