CAS 1822617-22-0 appears in our catalog under these names: 8-(tert-Butyl) 2-ethyl 3-oxo-8-azabicyclo(3.2.1)octane-2,8-dicarboxylate, 97%, 8–tert–Butyl 2–ethyl 3–oxo–8–azabicyclo(3·2·1)octane–2，8–dicarboxylate, 8-(tert-butyl) 2-ethyl 3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate, 97%, 97%, 8-tert-Butyl 2-ethyl 3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
8-O-tert-butyl 2-O-ethyl 3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (CAS 1822617-22-0) is a chemical compound with the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. IUPAC name: 8-O-tert-butyl 2-O-ethyl 3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate. InChIKey: QDRCEIFSUYFTIV-UHFFFAOYSA-N.
| Molecular formula | C15H23NO5 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | 8-O-tert-butyl 2-O-ethyl 3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| InChIKey | QDRCEIFSUYFTIV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2CCC(N2C(=O)OC(C)(C)C)CC1=O |
Computed by PubChem (NCBI)