CAS 2414412-99-8 appears in our catalog under these names: 8-(tert-Butyl) 3-ethyl 2-oxo-8-azabicyclo(3.2.1)octane-3,8-dicarboxylate, 98%, 8-tert-Butyl 3-ethyl 2-oxo-8-azabicyclo[3.2.1]octane-3,8-dicarboxylate, 97%, 8–tert–Butyl 3–ethyl 2–oxo–8–azabicyclo(3·2·1)octane–3,8–dicarboxylate, 8-tert-Butyl 3-ethyl 2-oxo-8-azabicyclo[3.2.1]octane-3,8-dicarboxylate, 97%, 97%. Offered by: AmBeed, Fluorochem, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
8-O-tert-butyl 3-O-ethyl 2-oxo-8-azabicyclo[3.2.1]octane-3,8-dicarboxylate (CAS 2414412-99-8) is a chemical compound with the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. IUPAC name: 8-O-tert-butyl 3-O-ethyl 2-oxo-8-azabicyclo[3.2.1]octane-3,8-dicarboxylate. InChIKey: AWILWMSNJPWXNR-UHFFFAOYSA-N.
| Molecular formula | C15H23NO5 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | 8-O-tert-butyl 3-O-ethyl 2-oxo-8-azabicyclo[3.2.1]octane-3,8-dicarboxylate |
| InChIKey | AWILWMSNJPWXNR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2CCC(C1=O)N2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)