Products 2783976-54-3
CAS 2783976-54-3 is the registry number for 2-(tert-Butyl) 6-ethyl (1R,5S)-7-oxo-2-azabicyclo[3.2.1]octane-2,6-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-tert-butyl 6-O-ethyl (1R,5S)-7-oxo-2-azabicyclo[3.2.1]octane-2,6-dicarboxylate (CAS 2783976-54-3) is a chemical compound with the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. IUPAC name: 2-O-tert-butyl 6-O-ethyl (1R,5S)-7-oxo-2-azabicyclo[3.2.1]octane-2,6-dicarboxylate. InChIKey: CLJWEFNNEJTWCN-MTULOOOASA-N.
| Molecular formula | C15H23NO5 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | 2-O-tert-butyl 6-O-ethyl (1R,5S)-7-oxo-2-azabicyclo[3.2.1]octane-2,6-dicarboxylate |
| InChIKey | CLJWEFNNEJTWCN-MTULOOOASA-N |
| SMILES | CCOC(=O)C1[C@H]2CCN([C@H](C2)C1=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)