Products 115956-03-1

CAS 115956-03-1 appears in our catalog under these names: Dolasetron Impurity 3, Dolasetron Impurity 5. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Ethyl 9-(2-ethoxy-2-oxoethyl)-7-oxo-9-azabicyclo[3.3.1]nonane-3-carboxylate (CAS 115956-03-1) is a chemical compound with the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. IUPAC name: ethyl 9-(2-ethoxy-2-oxoethyl)-7-oxo-9-azabicyclo[3.3.1]nonane-3-carboxylate. InChIKey: JCXUVTNCQZYKOG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23NO5
Molecular weight297.35 g/mol
IUPAC nameethyl 9-(2-ethoxy-2-oxoethyl)-7-oxo-9-azabicyclo[3.3.1]nonane-3-carboxylate
InChIKeyJCXUVTNCQZYKOG-UHFFFAOYSA-N
SMILESCCOC(=O)CN1C2CC(CC1CC(=O)C2)C(=O)OCC

Computed by PubChem (NCBI)