Products 1822579-28-1

CAS 1822579-28-1 is the registry number for 2-(tert-Butyl) 3-ethyl 5-oxo-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 3-O-ethyl 5-oxo-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate (CAS 1822579-28-1) is a chemical compound with the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. IUPAC name: 2-O-tert-butyl 3-O-ethyl 5-oxo-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate. InChIKey: VSHIYGMRWBFMTP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23NO5
Molecular weight297.35 g/mol
IUPAC name2-O-tert-butyl 3-O-ethyl 5-oxo-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate
InChIKeyVSHIYGMRWBFMTP-UHFFFAOYSA-N
SMILESCCOC(=O)C1C2CCC(N1C(=O)OC(C)(C)C)CC2=O

Computed by PubChem (NCBI)