Products 2080412-64-0
CAS 2080412-64-0 appears in our catalog under these names: 4-Bromo-2-chloro-1-(2,2,2-trifluoroethyl)benzene, 95%, 4-Bromo-2-chloro-1-(2,2,2-trifluoroethyl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-bromo-2-chloro-1-(2,2,2-trifluoroethyl)benzene (CAS 2080412-64-0) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 4-bromo-2-chloro-1-(2,2,2-trifluoroethyl)benzene. InChIKey: GJBOXQHMFCEJCL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 4-bromo-2-chloro-1-(2,2,2-trifluoroethyl)benzene |
| InChIKey | GJBOXQHMFCEJCL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)CC(F)(F)F |
Computed by PubChem (NCBI)