CAS 261763-24-0 appears in our catalog under these names: 5-Chloro-2(Trifluoromethyl)Benzyl Bromide, 2–(Bromomethyl)–4–chloro–1–(trifluoromethyl)benzene, 5-Chloro-2-(trifluoromethyl)benzyl bromide, 95%, 2-(Bromomethyl)-4-chloro-1-(trifluoromethyl)benzene, 95%. Offered by: TRC, GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
2-(bromomethyl)-4-chloro-1-(trifluoromethyl)benzene (CAS 261763-24-0) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 2-(bromomethyl)-4-chloro-1-(trifluoromethyl)benzene. InChIKey: OUNFGTVHRCWPKY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 2-(bromomethyl)-4-chloro-1-(trifluoromethyl)benzene |
| InChIKey | OUNFGTVHRCWPKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CBr)C(F)(F)F |
Computed by PubChem (NCBI)