CAS 1099597-31-5 is the registry number for 1-Bromo-4-(3,3,3-trifluoropropyl)benzene, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
1-bromo-4-(3,3,3-trifluoropropyl)benzene (CAS 1099597-31-5) is a chemical compound with the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. IUPAC name: 1-bromo-4-(3,3,3-trifluoropropyl)benzene. InChIKey: YRFFLHLXMDGVFT-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | 1-bromo-4-(3,3,3-trifluoropropyl)benzene |
| InChIKey | YRFFLHLXMDGVFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC(F)(F)F)Br |
Computed by PubChem (NCBI)