Products 886502-86-9
CAS 886502-86-9 is the registry number for 5-Methyl-2-(trifluoromethyl)benzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(bromomethyl)-4-methyl-1-(trifluoromethyl)benzene (CAS 886502-86-9) is a chemical compound with the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. IUPAC name: 2-(bromomethyl)-4-methyl-1-(trifluoromethyl)benzene. InChIKey: DCECDRXXOHBVSH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | 2-(bromomethyl)-4-methyl-1-(trifluoromethyl)benzene |
| InChIKey | DCECDRXXOHBVSH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(F)(F)F)CBr |
Computed by PubChem (NCBI)