Products 261952-17-4
CAS 261952-17-4 appears in our catalog under these names: 2-Methyl-5-(trifluoromethyl)benzyl bromide, 95%, 2-Methyl-5-(trifluoromethyl)benzyl bromide, 2-Methyl-5-(trifluoromethyl)benzyl bromide, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g.
2-(bromomethyl)-1-methyl-4-(trifluoromethyl)benzene (CAS 261952-17-4) is a chemical compound with the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. IUPAC name: 2-(bromomethyl)-1-methyl-4-(trifluoromethyl)benzene. InChIKey: ZQYDOVMTWZCBIH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | 2-(bromomethyl)-1-methyl-4-(trifluoromethyl)benzene |
| InChIKey | ZQYDOVMTWZCBIH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(F)(F)F)CBr |
Computed by PubChem (NCBI)