Products 261952-18-5
CAS 261952-18-5 appears in our catalog under these names: 4-Methyl-2-(trifluoromethyl)benzyl bromide, 95%, 4-Methyl-2-(trifluoromethyl)benzyl bromide, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-(bromomethyl)-4-methyl-2-(trifluoromethyl)benzene (CAS 261952-18-5) is a chemical compound with the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. IUPAC name: 1-(bromomethyl)-4-methyl-2-(trifluoromethyl)benzene. InChIKey: NMSCRLBUJIWGBQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | 1-(bromomethyl)-4-methyl-2-(trifluoromethyl)benzene |
| InChIKey | NMSCRLBUJIWGBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CBr)C(F)(F)F |
Computed by PubChem (NCBI)