Products 116070-36-1
CAS 116070-36-1 appears in our catalog under these names: 3-Methyl-5-(trifluoromethyl)benzyl bromide, 98%, 3-Methyl-5-(trifluoromethyl)benzyl bromide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g.
1-(bromomethyl)-3-methyl-5-(trifluoromethyl)benzene (CAS 116070-36-1) is a chemical compound with the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. IUPAC name: 1-(bromomethyl)-3-methyl-5-(trifluoromethyl)benzene. InChIKey: GZJBZDJGNUXMNN-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | 1-(bromomethyl)-3-methyl-5-(trifluoromethyl)benzene |
| InChIKey | GZJBZDJGNUXMNN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(F)(F)F)CBr |
Computed by PubChem (NCBI)