CAS 1099597-60-0 is the registry number for 1-Bromo-3-(3,3,3-trifluoropropyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-bromo-3-(3,3,3-trifluoropropyl)benzene (CAS 1099597-60-0) is a chemical compound with the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. IUPAC name: 1-bromo-3-(3,3,3-trifluoropropyl)benzene. InChIKey: OTAUAIBYXZXPHE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | 1-bromo-3-(3,3,3-trifluoropropyl)benzene |
| InChIKey | OTAUAIBYXZXPHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CCC(F)(F)F |
Computed by PubChem (NCBI)